C20H25FN2O2 — CID 97379111
(3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine (PubChem CID 97379111) has the molecular formula C20H25FN2O2 and a molecular weight of 344.43 g/mol. Its IUPAC name is (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine.
| Compound Name | (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
|---|---|
| PubChem CID | 97379111 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | (3R,3aS,7aR)-1-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-N-methyl-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-amine |
| SMILES | CN(Cc1ccco1)[C@@H]1CN(Cc2ccc(F)cc2)[C@@H]2CCCO[C@H]12 |
| InChI | InChI=1S/C20H25FN2O2/c1-22(13-17-4-2-10-24-17)19-14-23(18-5-3-11-25-20(18)19)12-15-6-8-16(21)9-7-15/h2,4,6-10,18-20H,3,5,11-14H2,1H3/t18-,19-,20+/m1/s1 |
| InChIKey | HLNIKLLWBFJUPU-AQNXPRMDSA-N |
| XLogP | 3.28 |
| TPSA | 28.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |