C19H29N3O3 — CID 125225529
[(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 125225529) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 125225529 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | CN(Cc1ccco1)C[C@@H]1OC[C@H]2CCN(C(=O)N3CCCC3)C[C@H]21 |
| InChI | InChI=1S/C19H29N3O3/c1-20(11-16-5-4-10-24-16)13-18-17-12-22(9-6-15(17)14-25-18)19(23)21-7-2-3-8-21/h4-5,10,15,17-18H,2-3,6-9,11-14H2,1H3/t15-,17-,18+/m1/s1 |
| InChIKey | DSUYTEYHJSPRDD-NXHRZFHOSA-N |
| XLogP | 2.26 |
| TPSA | 49.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |