C19H24N2O3S — CID 124816591
[(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone (PubChem CID 124816591) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone.
| Compound Name | [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 124816591 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | [(3R,3aS,7aS)-3-[[furan-2-ylmethyl(methyl)amino]methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-thiophen-3-ylmethanone |
| SMILES | CN(Cc1ccco1)C[C@@H]1OC[C@H]2CCN(C(=O)c3ccsc3)C[C@H]21 |
| InChI | InChI=1S/C19H24N2O3S/c1-20(9-16-3-2-7-23-16)11-18-17-10-21(6-4-14(17)12-24-18)19(22)15-5-8-25-13-15/h2-3,5,7-8,13-14,17-18H,4,6,9-12H2,1H3/t14-,17-,18+/m1/s1 |
| InChIKey | LYEZACXXBHPNSP-OLMNPRSZSA-N |
| XLogP | 2.95 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |