C21H24N2O3 — CID 7454564
[2-(1-adamantylmethylamino)-2-oxoethyl] 3-cyanobenzoate (PubChem CID 7454564) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-(1-adamantylmethylamino)-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 7454564 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | [2-(1-adamantylmethylamino)-2-oxoethyl] 3-cyanobenzoate |
| SMILES | N#Cc1cccc(C(=O)OCC(=O)NCC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C21H24N2O3/c22-11-14-2-1-3-18(7-14)20(25)26-12-19(24)23-13-21-8-15-4-16(9-21)6-17(5-15)10-21/h1-3,7,15-17H,4-6,8-10,12-13H2,(H,23,24) |
| InChIKey | QTHQSCXESMXQSC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |