C12H11N3O4 — CID 2635537
[2-(methylcarbamoylamino)-2-oxoethyl] 3-cyanobenzoate (PubChem CID 2635537) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 2635537 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-cyanobenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C12H11N3O4/c1-14-12(18)15-10(16)7-19-11(17)9-4-2-3-8(5-9)6-13/h2-5H,7H2,1H3,(H2,14,15,16,18) |
| InChIKey | SAMKNCYWFUYIJR-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |