C15H14N4O3 — CID 18127908
[2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 3-cyanobenzoate (PubChem CID 18127908) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 3-cyanobenzoate.
| Compound Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 3-cyanobenzoate |
|---|---|
| PubChem CID | 18127908 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-[(2,5-dimethylpyrazol-3-yl)amino]-2-oxoethyl] 3-cyanobenzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2cccc(C#N)c2)n(C)n1 |
| InChI | InChI=1S/C15H14N4O3/c1-10-6-13(19(2)18-10)17-14(20)9-22-15(21)12-5-3-4-11(7-12)8-16/h3-7H,9H2,1-2H3,(H,17,20) |
| InChIKey | DNOOQDVDWFQWDU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |