C14H15N5O — CID 47198183
1-[(3-cyanophenyl)methyl]-3-(2,5-dimethylpyrazol-3-yl)urea (PubChem CID 47198183) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is 1-[(3-cyanophenyl)methyl]-3-(2,5-dimethylpyrazol-3-yl)urea.
| Compound Name | 1-[(3-cyanophenyl)methyl]-3-(2,5-dimethylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 47198183 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 1-[(3-cyanophenyl)methyl]-3-(2,5-dimethylpyrazol-3-yl)urea |
| SMILES | Cc1cc(NC(=O)NCc2cccc(C#N)c2)n(C)n1 |
| InChI | InChI=1S/C14H15N5O/c1-10-6-13(19(2)18-10)17-14(20)16-9-12-5-3-4-11(7-12)8-15/h3-7H,9H2,1-2H3,(H2,16,17,20) |
| InChIKey | YGKJXMDHBCOERV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |