C11H10ClN3O2 — CID 62313877
2-chloro-N-[(3-cyanophenyl)methylcarbamoyl]acetamide (PubChem CID 62313877) has the molecular formula C11H10ClN3O2 and a molecular weight of 251.67 g/mol. Its IUPAC name is 2-chloro-N-[(3-cyanophenyl)methylcarbamoyl]acetamide.
| Compound Name | 2-chloro-N-[(3-cyanophenyl)methylcarbamoyl]acetamide |
|---|---|
| PubChem CID | 62313877 |
| Molecular Formula | C11H10ClN3O2 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 2-chloro-N-[(3-cyanophenyl)methylcarbamoyl]acetamide |
| SMILES | N#Cc1cccc(CNC(=O)NC(=O)CCl)c1 |
| InChI | InChI=1S/C11H10ClN3O2/c12-5-10(16)15-11(17)14-7-9-3-1-2-8(4-9)6-13/h1-4H,5,7H2,(H2,14,15,16,17) |
| InChIKey | WMSHCOFDXJJFRU-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|