C13H13N3O5 — CID 62312800
2-[2-[(3-cyanophenyl)methylcarbamoylamino]-2-oxoethoxy]acetic acid (PubChem CID 62312800) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-[2-[(3-cyanophenyl)methylcarbamoylamino]-2-oxoethoxy]acetic acid.
| Compound Name | 2-[2-[(3-cyanophenyl)methylcarbamoylamino]-2-oxoethoxy]acetic acid |
|---|---|
| PubChem CID | 62312800 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 2-[2-[(3-cyanophenyl)methylcarbamoylamino]-2-oxoethoxy]acetic acid |
| SMILES | N#Cc1cccc(CNC(=O)NC(=O)COCC(=O)O)c1 |
| InChI | InChI=1S/C13H13N3O5/c14-5-9-2-1-3-10(4-9)6-15-13(20)16-11(17)7-21-8-12(18)19/h1-4H,6-8H2,(H,18,19)(H2,15,16,17,20) |
| InChIKey | NHJQGPKWBMQPPX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |