C22H29N3O4 — CID 7260860
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-(dimethylamino)benzoate (PubChem CID 7260860) has the molecular formula C22H29N3O4 and a molecular weight of 399.49 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-(dimethylamino)benzoate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-(dimethylamino)benzoate |
|---|---|
| PubChem CID | 7260860 |
| Molecular Formula | C22H29N3O4 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 3-(dimethylamino)benzoate |
| SMILES | CN(C)c1cccc(C(=O)OCC(=O)NC(=O)NC23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H29N3O4/c1-25(2)18-5-3-4-17(9-18)20(27)29-13-19(26)23-21(28)24-22-10-14-6-15(11-22)8-16(7-14)12-22/h3-5,9,14-16H,6-8,10-13H2,1-2H3,(H2,23,24,26,28) |
| InChIKey | LKSQUDWJXKVXOT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |