C22H28N2O6 — CID 7854032
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate (PubChem CID 7854032) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7854032 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OCC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H28N2O6/c1-28-17-4-2-3-5-18(17)29-13-20(26)30-12-19(25)23-21(27)24-22-9-14-6-15(10-22)8-16(7-14)11-22/h2-5,14-16H,6-13H2,1H3,(H2,23,24,25,27) |
| InChIKey | WOLNPNXEVOJPJB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |