C21H26BrNO3 — CID 8528544
(4-bromophenyl)methyl 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528544) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is (4-bromophenyl)methyl 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (4-bromophenyl)methyl 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528544 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (4-bromophenyl)methyl 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C21H26BrNO3/c22-18-3-1-14(2-4-18)13-26-19(24)5-6-23-20(25)21-10-15-7-16(11-21)9-17(8-15)12-21/h1-4,15-17H,5-13H2,(H,23,25) |
| InChIKey | OBCTXJCNITWHQX-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |