C20H33NO3S — CID 86944040
2-tert-butylsulfanylethyl 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 86944040) has the molecular formula C20H33NO3S and a molecular weight of 367.56 g/mol. Its IUPAC name is 2-tert-butylsulfanylethyl 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | 2-tert-butylsulfanylethyl 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 86944040 |
| Molecular Formula | C20H33NO3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 2-tert-butylsulfanylethyl 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | CC(C)(C)SCCOC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H33NO3S/c1-19(2,3)25-7-6-24-17(22)4-5-21-18(23)20-11-14-8-15(12-20)10-16(9-14)13-20/h14-16H,4-13H2,1-3H3,(H,21,23) |
| InChIKey | SSIHHJSTRBKIPP-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|