C20H30N2O5 — CID 8528600
(2-morpholin-4-yl-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8528600) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8528600 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H30N2O5/c23-17(22-3-5-26-6-4-22)13-27-18(24)1-2-21-19(25)20-10-14-7-15(11-20)9-16(8-14)12-20/h14-16H,1-13H2,(H,21,25) |
| InChIKey | PMJBQMQAPMPBSX-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |