C17H17BrN2O5 — CID 7703284
[(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate (PubChem CID 7703284) has the molecular formula C17H17BrN2O5 and a molecular weight of 409.24 g/mol. Its IUPAC name is [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate.
| Compound Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 7703284 |
| Molecular Formula | C17H17BrN2O5 |
| Molecular Weight | 409.24 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[(5-bromofuran-2-carbonyl)amino]acetate |
| SMILES | CN(C)C(=O)[C@H](OC(=O)CNC(=O)c1ccc(Br)o1)c1ccccc1 |
| InChI | InChI=1S/C17H17BrN2O5/c1-20(2)17(23)15(11-6-4-3-5-7-11)25-14(21)10-19-16(22)12-8-9-13(18)24-12/h3-9,15H,10H2,1-2H3,(H,19,22)/t15-/m1/s1 |
| InChIKey | UWMSWWSJUWLGSC-OAHLLOKOSA-N |
| XLogP | 2.14 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.24 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |