C17H20BrN3O3 — CID 8936906
5-bromo-N-[2-[[(1S)-2-(dimethylamino)-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide (PubChem CID 8936906) has the molecular formula C17H20BrN3O3 and a molecular weight of 394.27 g/mol. Its IUPAC name is 5-bromo-N-[2-[[(1S)-2-(dimethylamino)-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[[(1S)-2-(dimethylamino)-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 8936906 |
| Molecular Formula | C17H20BrN3O3 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 5-bromo-N-[2-[[(1S)-2-(dimethylamino)-1-phenylethyl]amino]-2-oxoethyl]furan-2-carboxamide |
| SMILES | CN(C)C[C@@H](NC(=O)CNC(=O)c1ccc(Br)o1)c1ccccc1 |
| InChI | InChI=1S/C17H20BrN3O3/c1-21(2)11-13(12-6-4-3-5-7-12)20-16(22)10-19-17(23)14-8-9-15(18)24-14/h3-9,13H,10-11H2,1-2H3,(H,19,23)(H,20,22)/t13-/m1/s1 |
| InChIKey | HVWJETBJBOKBJO-CYBMUJFWSA-N |
| XLogP | 2.19 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |