C26H36N2O4 — CID 98365525
[2-[benzyl(tert-butyl)amino]-2-oxoethyl] (5S,7S)-3-acetamidoadamantane-1-carboxylate (PubChem CID 98365525) has the molecular formula C26H36N2O4 and a molecular weight of 440.58 g/mol. Its IUPAC name is [2-[benzyl(tert-butyl)amino]-2-oxoethyl] (5S,7S)-3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] (5S,7S)-3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 98365525 |
| Molecular Formula | C26H36N2O4 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | [2-[benzyl(tert-butyl)amino]-2-oxoethyl] (5S,7S)-3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12C[C@H]3C[C@H](C1)CC(C(=O)OCC(=O)N(Cc1ccccc1)C(C)(C)C)(C3)C2 |
| InChI | InChI=1S/C26H36N2O4/c1-18(29)27-26-13-20-10-21(14-26)12-25(11-20,17-26)23(31)32-16-22(30)28(24(2,3)4)15-19-8-6-5-7-9-19/h5-9,20-21H,10-17H2,1-4H3,(H,27,29)/t20-,21-,25?,26?/m0/s1 |
| InChIKey | DGBUQXFWWOWLFE-ITYMFSOSSA-N |
| XLogP | 3.83 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |