C20H26N2O3 — CID 88764230
[(2S)-2-amino-3-phenylpropanoyl] 3-aminoadamantane-1-carboxylate (PubChem CID 88764230) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(2S)-2-amino-3-phenylpropanoyl] 3-aminoadamantane-1-carboxylate.
| Compound Name | [(2S)-2-amino-3-phenylpropanoyl] 3-aminoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 88764230 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | [(2S)-2-amino-3-phenylpropanoyl] 3-aminoadamantane-1-carboxylate |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)OC(=O)C12CC3CC(CC(N)(C3)C1)C2 |
| InChI | InChI=1S/C20H26N2O3/c21-16(7-13-4-2-1-3-5-13)17(23)25-18(24)19-8-14-6-15(9-19)11-20(22,10-14)12-19/h1-5,14-16H,6-12,21-22H2/t14?,15?,16-,19?,20?/m0/s1 |
| InChIKey | IMVABPQPYTWIHL-WILFJHKZSA-N |
| XLogP | 1.92 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|