C18H26BNO2 — CID 10063306
(2S)-2-amino-3-phenylpropanoic acid;1-boratricyclo[3.3.1.13,7]decane (PubChem CID 10063306) has the molecular formula C18H26BNO2 and a molecular weight of 299.22 g/mol. Its IUPAC name is (2S)-2-amino-3-phenylpropanoic acid;1-boratricyclo[3.3.1.13,7]decane.
| Compound Name | (2S)-2-amino-3-phenylpropanoic acid;1-boratricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 10063306 |
| Molecular Formula | C18H26BNO2 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | (2S)-2-amino-3-phenylpropanoic acid;1-boratricyclo[3.3.1.13,7]decane |
| SMILES | C1B2CC3CC1CC(C2)C3.N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C9H15B.C9H11NO2/c1-7-2-9-3-8(1)5-10(4-7)6-9;10-8(9(11)12)6-7-4-2-1-3-5-7/h7-9H,1-6H2;1-5,8H,6,10H2,(H,11,12)/t;8-/m.0/s1 |
| InChIKey | AOFHSPIHNCEUEQ-WDBKTSHHSA-N |
| XLogP | 3.18 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|