C20H28N2O2 — CID 70568208
(3S)-3-amino-1-(3-amino-1-adamantyl)-1-hydroxy-4-phenylbutan-2-one (PubChem CID 70568208) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is (3S)-3-amino-1-(3-amino-1-adamantyl)-1-hydroxy-4-phenylbutan-2-one.
| Compound Name | (3S)-3-amino-1-(3-amino-1-adamantyl)-1-hydroxy-4-phenylbutan-2-one |
|---|---|
| PubChem CID | 70568208 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | (3S)-3-amino-1-(3-amino-1-adamantyl)-1-hydroxy-4-phenylbutan-2-one |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)C(O)C12CC3CC(CC(N)(C3)C1)C2 |
| InChI | InChI=1S/C20H28N2O2/c21-16(7-13-4-2-1-3-5-13)17(23)18(24)19-8-14-6-15(9-19)11-20(22,10-14)12-19/h1-5,14-16,18,24H,6-12,21-22H2/t14?,15?,16-,18?,19?,20?/m0/s1 |
| InChIKey | FKTOXGPHSVAINB-NALRYKRRSA-N |
| XLogP | 1.78 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |