C21H22Cl2N2O3 — CID 87841001
2,8-diamino-4,6-dichloro-1,9-diphenylnonane-3,5,7-trione (PubChem CID 87841001) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2,8-diamino-4,6-dichloro-1,9-diphenylnonane-3,5,7-trione.
| Compound Name | 2,8-diamino-4,6-dichloro-1,9-diphenylnonane-3,5,7-trione |
|---|---|
| PubChem CID | 87841001 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2,8-diamino-4,6-dichloro-1,9-diphenylnonane-3,5,7-trione |
| SMILES | NC(Cc1ccccc1)C(=O)C(Cl)C(=O)C(Cl)C(=O)C(N)Cc1ccccc1 |
| InChI | InChI=1S/C21H22Cl2N2O3/c22-17(19(26)15(24)11-13-7-3-1-4-8-13)21(28)18(23)20(27)16(25)12-14-9-5-2-6-10-14/h1-10,15-18H,11-12,24-25H2 |
| InChIKey | ZZGAZUBMJYEUHS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|