C15H24O5S — CID 160838459
carbanylium;2-(3-methyladamantane-1-carbonyl)oxyethanesulfonate (PubChem CID 160838459) has the molecular formula C15H24O5S and a molecular weight of 316.42 g/mol. Its IUPAC name is carbanylium;2-(3-methyladamantane-1-carbonyl)oxyethanesulfonate.
| Compound Name | carbanylium;2-(3-methyladamantane-1-carbonyl)oxyethanesulfonate |
|---|---|
| PubChem CID | 160838459 |
| Molecular Formula | C15H24O5S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | carbanylium;2-(3-methyladamantane-1-carbonyl)oxyethanesulfonate |
| SMILES | CC12CC3CC(C1)CC(C(=O)OCCS(=O)(=O)[O-])(C3)C2.[CH3+] |
| InChI | InChI=1S/C14H22O5S.CH3/c1-13-5-10-4-11(6-13)8-14(7-10,9-13)12(15)19-2-3-20(16,17)18;/h10-11H,2-9H2,1H3,(H,16,17,18);1H3/q;+1/p-1 |
| InChIKey | SHSAZFZXAYFEJZ-UHFFFAOYSA-M |
| XLogP | 2.13 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|