About 2-acetyloxyethanesulfonate;adamantane
2-acetyloxyethanesulfonate;adamantane (PubChem CID 90789573) has the molecular formula C14H23O5S-
and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-acetyloxyethanesulfonate;adamantane.
Molecular Properties
| Compound Name | 2-acetyloxyethanesulfonate;adamantane |
| PubChem CID | 90789573 |
| Molecular Formula | C14H23O5S- |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 2-acetyloxyethanesulfonate;adamantane |
| SMILES | C1C2CC3CC1CC(C2)C3.CC(=O)OCCS(=O)(=O)[O-] |
| InChI | InChI=1S/C10H16.C4H8O5S/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4(5)9-2-3-10(6,7)8/h7-10H,1-6H2;2-3H2,1H3,(H,6,7,8)/p-1 |
| InChIKey | OHNAHOYXEGNNBS-UHFFFAOYSA-M |
| XLogP | 1.93 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-acetyloxyethanesulfonate;adamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetyloxyethanesulfonate;adamantane?
The IUPAC name of 2-acetyloxyethanesulfonate;adamantane (CID 90789573) is 2-acetyloxyethanesulfonate;adamantane.
What is the SMILES notation for 2-acetyloxyethanesulfonate;adamantane?
The canonical SMILES for 2-acetyloxyethanesulfonate;adamantane is C1C2CC3CC1CC(C2)C3.CC(=O)OCCS(=O)(=O)[O-].
What is the InChIKey of 2-acetyloxyethanesulfonate;adamantane?
The InChIKey is OHNAHOYXEGNNBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16.C4H8O5S/c1-7-2-9-4-8(1)5-10(3-7)6-9;1-4(5)9-2-3-10(6,7)8/h7-10H,1-6H2;2-3H2,1H3,(H,6,7,8)/p-1.
What are the key properties of 2-acetyloxyethanesulfonate;adamantane?
2-acetyloxyethanesulfonate;adamantane has a molecular weight of 303.40 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetyloxyethanesulfonate;adamantane is sourced from PubChem (CID 90789573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).