C19H30N2O4 — CID 9017863
[2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] adamantane-1-carboxylate (PubChem CID 9017863) has the molecular formula C19H30N2O4 and a molecular weight of 350.46 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] adamantane-1-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 9017863 |
| Molecular Formula | C19H30N2O4 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | [2-oxo-2-[[(2S)-1-oxo-1-(propylamino)propan-2-yl]amino]ethyl] adamantane-1-carboxylate |
| SMILES | CCCNC(=O)[C@H](C)NC(=O)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H30N2O4/c1-3-4-20-17(23)12(2)21-16(22)11-25-18(24)19-8-13-5-14(9-19)7-15(6-13)10-19/h12-15H,3-11H2,1-2H3,(H,20,23)(H,21,22)/t12-,13?,14?,15?,19?/m0/s1 |
| InChIKey | ORLRVAHXZOSICI-UHSVVUDUSA-N |
| XLogP | 1.78 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |