C23H25NO3 — CID 7867122
[2-(naphthalen-1-ylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 7867122) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [2-(naphthalen-1-ylamino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7867122 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-(naphthalen-1-ylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C23H25NO3/c25-21(24-20-7-3-5-18-4-1-2-6-19(18)20)14-27-22(26)23-11-15-8-16(12-23)10-17(9-15)13-23/h1-7,15-17H,8-14H2,(H,24,25) |
| InChIKey | REGFIEHYMIUMAP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |