C28H40MgN2O8 — CID 158348116
magnesium bis(2-[2-(2-adamantylamino)-2-oxoethoxy]acetate) (PubChem CID 158348116) has the molecular formula C28H40MgN2O8 and a molecular weight of 556.94 g/mol. Its IUPAC name is magnesium bis(2-[2-(2-adamantylamino)-2-oxoethoxy]acetate).
| Compound Name | magnesium bis(2-[2-(2-adamantylamino)-2-oxoethoxy]acetate) |
|---|---|
| PubChem CID | 158348116 |
| Molecular Formula | C28H40MgN2O8 |
| Molecular Weight | 556.94 g/mol |
| Exact Mass | 556.26 |
| IUPAC Name | magnesium bis(2-[2-(2-adamantylamino)-2-oxoethoxy]acetate) |
| SMILES | O=C([O-])COCC(=O)NC1C2CC3CC(C2)CC1C3.O=C([O-])COCC(=O)NC1C2CC3CC(C2)CC1C3.[Mg+2] |
| InChI | InChI=1S/2C14H21NO4.Mg/c2*16-12(6-19-7-13(17)18)15-14-10-2-8-1-9(4-10)5-11(14)3-8;/h2*8-11,14H,1-7H2,(H,15,16)(H,17,18);/q;;+2/p-2 |
| InChIKey | GRZGLOPWRYLKGX-UHFFFAOYSA-L |
| XLogP | -0.99 |
| TPSA | 156.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.94 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |