C23H27ClN2OS — CID 7669216
N-[(1S)-1-(1-adamantyl)ethyl]-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 7669216) has the molecular formula C23H27ClN2OS and a molecular weight of 415.00 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 7669216 |
| Molecular Formula | C23H27ClN2OS |
| Molecular Weight | 415.00 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | C[C@H](NC(=O)Cc1csc(-c2ccccc2Cl)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H27ClN2OS/c1-14(23-10-15-6-16(11-23)8-17(7-15)12-23)25-21(27)9-18-13-28-22(26-18)19-4-2-3-5-20(19)24/h2-5,13-17H,6-12H2,1H3,(H,25,27)/t14-,15?,16?,17?,23?/m0/s1 |
| InChIKey | QTUKJYHTXVSEKL-NSDYXAQKSA-N |
| XLogP | 5.73 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.00 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |