C21H26N2OS2 — CID 8927323
N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 8927323) has the molecular formula C21H26N2OS2 and a molecular weight of 386.59 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 8927323 |
| Molecular Formula | C21H26N2OS2 |
| Molecular Weight | 386.59 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | C[C@@H](NC(=O)Cc1csc(-c2ccsc2)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26N2OS2/c1-13(21-8-14-4-15(9-21)6-16(5-14)10-21)22-19(24)7-18-12-26-20(23-18)17-2-3-25-11-17/h2-3,11-16H,4-10H2,1H3,(H,22,24)/t13-,14?,15?,16?,21?/m1/s1 |
| InChIKey | AOZRMBBUPFBPGZ-BUBBNXEVSA-N |
| XLogP | 5.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |