C22H31NOS — CID 7929244
N-[(1R)-1-(1-adamantyl)ethyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide (PubChem CID 7929244) has the molecular formula C22H31NOS and a molecular weight of 357.56 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 7929244 |
| Molecular Formula | C22H31NOS |
| Molecular Weight | 357.56 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-[(3-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1cccc(CSCC(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C22H31NOS/c1-15-4-3-5-17(6-15)13-25-14-21(24)23-16(2)22-10-18-7-19(11-22)9-20(8-18)12-22/h3-6,16,18-20H,7-14H2,1-2H3,(H,23,24)/t16-,18?,19?,20?,22?/m1/s1 |
| InChIKey | DVACATUHDKGWGP-HJMJHHSWSA-N |
| XLogP | 4.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |