C18H27N5OS — CID 4991617
N-[1-(1-adamantyl)ethyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide (PubChem CID 4991617) has the molecular formula C18H27N5OS and a molecular weight of 361.52 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 4991617 |
| Molecular Formula | C18H27N5OS |
| Molecular Weight | 361.52 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(4,6-diaminopyrimidin-2-yl)sulfanylacetamide |
| SMILES | CC(NC(=O)CSc1nc(N)cc(N)n1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27N5OS/c1-10(18-6-11-2-12(7-18)4-13(3-11)8-18)21-16(24)9-25-17-22-14(19)5-15(20)23-17/h5,10-13H,2-4,6-9H2,1H3,(H,21,24)(H4,19,20,22,23) |
| InChIKey | KSIYQTPXTUXXOS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.52 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |