C20H25F2NOS — CID 7737036
N-[(1S)-1-(1-adamantyl)ethyl]-2-(3,4-difluorophenyl)sulfanylacetamide (PubChem CID 7737036) has the molecular formula C20H25F2NOS and a molecular weight of 365.49 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(3,4-difluorophenyl)sulfanylacetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(3,4-difluorophenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7737036 |
| Molecular Formula | C20H25F2NOS |
| Molecular Weight | 365.49 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(3,4-difluorophenyl)sulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1ccc(F)c(F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25F2NOS/c1-12(20-8-13-4-14(9-20)6-15(5-13)10-20)23-19(24)11-25-16-2-3-17(21)18(22)7-16/h2-3,7,12-15H,4-6,8-11H2,1H3,(H,23,24)/t12-,13?,14?,15?,20?/m0/s1 |
| InChIKey | QCRVLBZILSPDJQ-PGBBXINNSA-N |
| XLogP | 4.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |