C21H26F3NOS — CID 7484677
N-[(1S)-1-(1-adamantyl)ethyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide (PubChem CID 7484677) has the molecular formula C21H26F3NOS and a molecular weight of 397.51 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 7484677 |
| Molecular Formula | C21H26F3NOS |
| Molecular Weight | 397.51 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-[3-(trifluoromethyl)phenyl]sulfanylacetamide |
| SMILES | C[C@H](NC(=O)CSc1cccc(C(F)(F)F)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26F3NOS/c1-13(20-9-14-5-15(10-20)7-16(6-14)11-20)25-19(26)12-27-18-4-2-3-17(8-18)21(22,23)24/h2-4,8,13-16H,5-7,9-12H2,1H3,(H,25,26)/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | AEZXKLWOXLDESB-IVKJLDKCSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |