C17H18Cl2N2OS2 — CID 2405925
3,6-dichloro-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]-1-benzothiophene-2-carboxamide (PubChem CID 2405925) has the molecular formula C17H18Cl2N2OS2 and a molecular weight of 401.38 g/mol. Its IUPAC name is 3,6-dichloro-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 2405925 |
| Molecular Formula | C17H18Cl2N2OS2 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 400.02 |
| IUPAC Name | 3,6-dichloro-N-[[(1S,2R)-2-methylcyclohexyl]carbamothioyl]-1-benzothiophene-2-carboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1NC(=S)NC(=O)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C17H18Cl2N2OS2/c1-9-4-2-3-5-12(9)20-17(23)21-16(22)15-14(19)11-7-6-10(18)8-13(11)24-15/h6-9,12H,2-5H2,1H3,(H2,20,21,22,23)/t9-,12+/m1/s1 |
| InChIKey | OQPQGIWVJZUOGT-SKDRFNHKSA-N |
| XLogP | 5.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|