C14H14Cl2N2OS — CID 119389377
3,6-dichloro-N-piperidin-4-yl-1-benzothiophene-2-carboxamide (PubChem CID 119389377) has the molecular formula C14H14Cl2N2OS and a molecular weight of 329.25 g/mol. Its IUPAC name is 3,6-dichloro-N-piperidin-4-yl-1-benzothiophene-2-carboxamide.
| Compound Name | 3,6-dichloro-N-piperidin-4-yl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 119389377 |
| Molecular Formula | C14H14Cl2N2OS |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 3,6-dichloro-N-piperidin-4-yl-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCNCC1)c1sc2cc(Cl)ccc2c1Cl |
| InChI | InChI=1S/C14H14Cl2N2OS/c15-8-1-2-10-11(7-8)20-13(12(10)16)14(19)18-9-3-5-17-6-4-9/h1-2,7,9,17H,3-6H2,(H,18,19) |
| InChIKey | REGUHCOFQNGXIV-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |