C23H27N3O3S — CID 4926917
N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-ethoxybenzamide (PubChem CID 4926917) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-ethoxybenzamide.
| Compound Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 4926917 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-[[2-(azepane-1-carbonyl)phenyl]carbamothioyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccccc1C(=O)NC(=S)Nc1ccccc1C(=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-29-20-14-8-6-12-18(20)21(27)25-23(30)24-19-13-7-5-11-17(19)22(28)26-15-9-3-4-10-16-26/h5-8,11-14H,2-4,9-10,15-16H2,1H3,(H2,24,25,27,30) |
| InChIKey | RKAWETPHCCKYTA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|