C16H13ClFN3OS — CID 9469163
1-(4-chlorophenyl)-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea (PubChem CID 9469163) has the molecular formula C16H13ClFN3OS and a molecular weight of 349.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-(4-chlorophenyl)-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9469163 |
| Molecular Formula | C16H13ClFN3OS |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NNC(=S)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClFN3OS/c17-12-4-8-14(9-5-12)19-16(23)21-20-15(22)10-3-11-1-6-13(18)7-2-11/h1-10H,(H,20,22)(H2,19,21,23)/b10-3+ |
| InChIKey | MLMJGDKBVVNTAX-XCVCLJGOSA-N |
| XLogP | 3.51 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|