C14H18FN3OS — CID 9425511
1-tert-butyl-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea (PubChem CID 9425511) has the molecular formula C14H18FN3OS and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-tert-butyl-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425511 |
| Molecular Formula | C14H18FN3OS |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 1-tert-butyl-3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C14H18FN3OS/c1-14(2,3)16-13(20)18-17-12(19)9-6-10-4-7-11(15)8-5-10/h4-9H,1-3H3,(H,17,19)(H2,16,18,20)/b9-6+ |
| InChIKey | ZZQZVVNBMKMVTD-RMKNXTFCSA-N |
| XLogP | 2.13 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|