C16H24FN2O+ — CID 9084038
[3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2,2-dimethylpropyl]-dimethylazanium (PubChem CID 9084038) has the molecular formula C16H24FN2O+ and a molecular weight of 279.38 g/mol. Its IUPAC name is [3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2,2-dimethylpropyl]-dimethylazanium.
| Compound Name | [3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2,2-dimethylpropyl]-dimethylazanium |
|---|---|
| PubChem CID | 9084038 |
| Molecular Formula | C16H24FN2O+ |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | [3-[[(E)-3-(4-fluorophenyl)prop-2-enoyl]amino]-2,2-dimethylpropyl]-dimethylazanium |
| SMILES | C[NH+](C)CC(C)(C)CNC(=O)/C=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C16H23FN2O/c1-16(2,12-19(3)4)11-18-15(20)10-7-13-5-8-14(17)9-6-13/h5-10H,11-12H2,1-4H3,(H,18,20)/p+1/b10-7+ |
| InChIKey | IWMOYACXNWHHFY-JXMROGBWSA-O |
| XLogP | 1.13 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|