C25H18F3N5O5S — CID 98418480
(2R)-2-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide (PubChem CID 98418480) has the molecular formula C25H18F3N5O5S and a molecular weight of 557.51 g/mol. Its IUPAC name is (2R)-2-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide.
| Compound Name | (2R)-2-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 98418480 |
| Molecular Formula | C25H18F3N5O5S |
| Molecular Weight | 557.51 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | (2R)-2-[[5-(1,3-benzodioxol-5-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-N-[4-nitro-2-(trifluoromethyl)phenyl]propanamide |
| SMILES | C[C@@H](Sc1nnc(-c2ccc3c(c2)OCO3)n1-c1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C25H18F3N5O5S/c1-14(23(34)29-19-9-8-17(33(35)36)12-18(19)25(26,27)28)39-24-31-30-22(32(24)16-5-3-2-4-6-16)15-7-10-20-21(11-15)38-13-37-20/h2-12,14H,13H2,1H3,(H,29,34)/t14-/m1/s1 |
| InChIKey | NYNCJUJDDXZMDU-CQSZACIVSA-N |
| XLogP | 5.71 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.51 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|