C20H15F3N2O7 — CID 92830217
[(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 92830217) has the molecular formula C20H15F3N2O7 and a molecular weight of 452.34 g/mol. Its IUPAC name is [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 92830217 |
| Molecular Formula | C20H15F3N2O7 |
| Molecular Weight | 452.34 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | [(2R)-1-[4-nitro-2-(trifluoromethyl)anilino]-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@@H](OC(=O)/C=C/c1ccc2c(c1)OCO2)C(=O)Nc1ccc([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C20H15F3N2O7/c1-11(32-18(26)7-3-12-2-6-16-17(8-12)31-10-30-16)19(27)24-15-5-4-13(25(28)29)9-14(15)20(21,22)23/h2-9,11H,10H2,1H3,(H,24,27)/b7-3+/t11-/m1/s1 |
| InChIKey | UMQLBRVHYBTZGJ-CGAJTASUSA-N |
| XLogP | 3.93 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|