C23H20N6O3S — CID 1206437
(2R)-N-(2-methyl-5-nitrophenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide (PubChem CID 1206437) has the molecular formula C23H20N6O3S and a molecular weight of 460.52 g/mol. Its IUPAC name is (2R)-N-(2-methyl-5-nitrophenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide.
| Compound Name | (2R)-N-(2-methyl-5-nitrophenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 1206437 |
| Molecular Formula | C23H20N6O3S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | (2R)-N-(2-methyl-5-nitrophenyl)-2-[(4-phenyl-5-pyridin-3-yl-1,2,4-triazol-3-yl)sulfanyl]propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)Sc1nnc(-c2cccnc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H20N6O3S/c1-15-10-11-19(29(31)32)13-20(15)25-22(30)16(2)33-23-27-26-21(17-7-6-12-24-14-17)28(23)18-8-4-3-5-9-18/h3-14,16H,1-2H3,(H,25,30)/t16-/m1/s1 |
| InChIKey | FCXSDGAXAFAVEN-MRXNPFEDSA-N |
| XLogP | 4.67 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|