C19H19N5O4S — CID 1076948
(2R)-2-[[5-(4-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide (PubChem CID 1076948) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is (2R)-2-[[5-(4-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[[5-(4-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 1076948 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | (2R)-2-[[5-(4-hydroxyphenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H](C)Sc1nnc(-c2ccc(O)cc2)n1C |
| InChI | InChI=1S/C19H19N5O4S/c1-11-4-7-14(24(27)28)10-16(11)20-18(26)12(2)29-19-22-21-17(23(19)3)13-5-8-15(25)9-6-13/h4-10,12,25H,1-3H3,(H,20,26)/t12-/m1/s1 |
| InChIKey | DOOVBUQIDSTVSI-GFCCVEGCSA-N |
| XLogP | 3.52 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|