C22H25ClN6O3S — CID 43029913
N-(2-chloro-4-nitrophenyl)-2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 43029913) has the molecular formula C22H25ClN6O3S and a molecular weight of 489.00 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 43029913 |
| Molecular Formula | C22H25ClN6O3S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-[[5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | CCN(CC)c1ccc(-c2nnc(SC(C)C(=O)Nc3ccc([N+](=O)[O-])cc3Cl)n2C)cc1 |
| InChI | InChI=1S/C22H25ClN6O3S/c1-5-28(6-2)16-9-7-15(8-10-16)20-25-26-22(27(20)4)33-14(3)21(30)24-19-12-11-17(29(31)32)13-18(19)23/h7-14H,5-6H2,1-4H3,(H,24,30) |
| InChIKey | LYTXATKDSNLYME-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 106.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|