C20H20N6O6S — CID 3143172
2-[[4-methyl-5-[(4-nitrophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide (PubChem CID 3143172) has the molecular formula C20H20N6O6S and a molecular weight of 472.48 g/mol. Its IUPAC name is 2-[[4-methyl-5-[(4-nitrophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide.
| Compound Name | 2-[[4-methyl-5-[(4-nitrophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 3143172 |
| Molecular Formula | C20H20N6O6S |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | 2-[[4-methyl-5-[(4-nitrophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(2-methyl-5-nitrophenyl)propanamide |
| SMILES | Cc1ccc([N+](=O)[O-])cc1NC(=O)C(C)Sc1nnc(COc2ccc([N+](=O)[O-])cc2)n1C |
| InChI | InChI=1S/C20H20N6O6S/c1-12-4-5-15(26(30)31)10-17(12)21-19(27)13(2)33-20-23-22-18(24(20)3)11-32-16-8-6-14(7-9-16)25(28)29/h4-10,13H,11H2,1-3H3,(H,21,27) |
| InChIKey | YHBRGEQSWAEFCM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|