C21H25FN2O2S — CID 49154044
2-[1-(2-fluorophenyl)ethylsulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 49154044) has the molecular formula C21H25FN2O2S and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[1-(2-fluorophenyl)ethylsulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[1-(2-fluorophenyl)ethylsulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 49154044 |
| Molecular Formula | C21H25FN2O2S |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[1-(2-fluorophenyl)ethylsulfanyl]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CC(SC(C)c1ccccc1F)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C21H25FN2O2S/c1-15(19-5-3-4-6-20(19)22)27-16(2)21(25)23-17-7-9-18(10-8-17)24-11-13-26-14-12-24/h3-10,15-16H,11-14H2,1-2H3,(H,23,25) |
| InChIKey | YOIKWYGXXJOJJP-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|