C16H26N3O3+ — CID 7998281
3-hydroxypropyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium (PubChem CID 7998281) has the molecular formula C16H26N3O3+ and a molecular weight of 308.40 g/mol. Its IUPAC name is 3-hydroxypropyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium.
| Compound Name | 3-hydroxypropyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium |
|---|---|
| PubChem CID | 7998281 |
| Molecular Formula | C16H26N3O3+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 3-hydroxypropyl-[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl]azanium |
| SMILES | C[C@H]([NH2+]CCCO)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C16H25N3O3/c1-13(17-7-2-10-20)16(21)18-14-3-5-15(6-4-14)19-8-11-22-12-9-19/h3-6,13,17,20H,2,7-12H2,1H3,(H,18,21)/p+1/t13-/m0/s1 |
| InChIKey | BMTZGPUORSMHCC-ZDUSSCGKSA-O |
| XLogP | -0.20 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|