C26H26FN3O3 — CID 4880357
2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 4880357) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 4880357 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[4-(2-fluorophenyl)piperazin-1-yl]-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)C(C)N1CCN(c3ccccc3F)CC1)oc1ccccc12 |
| InChI | InChI=1S/C26H26FN3O3/c1-17(29-11-13-30(14-12-29)22-9-5-4-8-20(22)27)26(31)28-21-16-24-19(15-25(21)32-2)18-7-3-6-10-23(18)33-24/h3-10,15-17H,11-14H2,1-2H3,(H,28,31) |
| InChIKey | DFSPTFFPFKCHMG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |