C27H29N3O4 — CID 40937996
(2R)-N-(2-methoxydibenzofuran-3-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]propanamide (PubChem CID 40937996) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is (2R)-N-(2-methoxydibenzofuran-3-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(2-methoxydibenzofuran-3-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 40937996 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | (2R)-N-(2-methoxydibenzofuran-3-yl)-2-[4-(3-methoxyphenyl)piperazin-1-yl]propanamide |
| SMILES | COc1cccc(N2CCN([C@H](C)C(=O)Nc3cc4oc5ccccc5c4cc3OC)CC2)c1 |
| InChI | InChI=1S/C27H29N3O4/c1-18(29-11-13-30(14-12-29)19-7-6-8-20(15-19)32-2)27(31)28-23-17-25-22(16-26(23)33-3)21-9-4-5-10-24(21)34-25/h4-10,15-18H,11-14H2,1-3H3,(H,28,31)/t18-/m1/s1 |
| InChIKey | OZQBEOAURJRACC-GOSISDBHSA-N |
| XLogP | 4.75 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |