C13H18Cl3FN2O3S — CID 120719012
[1-(2,4-dichloro-3-fluorophenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride (PubChem CID 120719012) has the molecular formula C13H18Cl3FN2O3S and a molecular weight of 407.72 g/mol. Its IUPAC name is [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride.
| Compound Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120719012 |
| Molecular Formula | C13H18Cl3FN2O3S |
| Molecular Weight | 407.72 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-4-methoxypiperidin-2-yl]methanamine;hydrochloride |
| SMILES | COC1CCN(S(=O)(=O)c2ccc(Cl)c(F)c2Cl)C(CN)C1.Cl |
| InChI | InChI=1S/C13H17Cl2FN2O3S.ClH/c1-21-9-4-5-18(8(6-9)7-17)22(19,20)11-3-2-10(14)13(16)12(11)15;/h2-3,8-9H,4-7,17H2,1H3;1H |
| InChIKey | METCNBQCEQYMER-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.72 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|