About [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine
[1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine (PubChem CID 103089185) has the molecular formula C12H15Cl2FN2O2S
and a molecular weight of 341.24 g/mol. Its IUPAC name is [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine |
| PubChem CID | 103089185 |
| Molecular Formula | C12H15Cl2FN2O2S |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1CC(CN)CN1S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O2S/c1-7-4-8(5-16)6-17(7)20(18,19)10-3-2-9(13)12(15)11(10)14/h2-3,7-8H,4-6,16H2,1H3 |
| InChIKey | ZJZJUEYTGTXKGC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine?
The IUPAC name of [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine (CID 103089185) is [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine.
What is the SMILES notation for [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine?
The canonical SMILES for [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine is CC1CC(CN)CN1S(=O)(=O)c1ccc(Cl)c(F)c1Cl.
What is the InChIKey of [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine?
The InChIKey is ZJZJUEYTGTXKGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl2FN2O2S/c1-7-4-8(5-16)6-17(7)20(18,19)10-3-2-9(13)12(15)11(10)14/h2-3,7-8H,4-6,16H2,1H3.
What are the key properties of [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine?
[1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine has a molecular weight of 341.24 g/mol, XLogP of 2.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine is sourced from PubChem (CID 103089185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).