C12H15Cl2FN2O2S — CID 103089185
[1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine (PubChem CID 103089185) has the molecular formula C12H15Cl2FN2O2S and a molecular weight of 341.24 g/mol. Its IUPAC name is [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine.
| Compound Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 103089185 |
| Molecular Formula | C12H15Cl2FN2O2S |
| Molecular Weight | 341.24 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | [1-(2,4-dichloro-3-fluorophenyl)sulfonyl-5-methylpyrrolidin-3-yl]methanamine |
| SMILES | CC1CC(CN)CN1S(=O)(=O)c1ccc(Cl)c(F)c1Cl |
| InChI | InChI=1S/C12H15Cl2FN2O2S/c1-7-4-8(5-16)6-17(7)20(18,19)10-3-2-9(13)12(15)11(10)14/h2-3,7-8H,4-6,16H2,1H3 |
| InChIKey | ZJZJUEYTGTXKGC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.24 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|